C7H13N3O3 — CID 107409933
4-(2-hydroxy-2-methylbutyl)-1,2,4-triazolidine-3,5-dione (PubChem CID 107409933) has the molecular formula C7H13N3O3 and a molecular weight of 187.20 g/mol. Its IUPAC name is 4-(2-hydroxy-2-methylbutyl)-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-(2-hydroxy-2-methylbutyl)-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 107409933 |
| Molecular Formula | C7H13N3O3 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 4-(2-hydroxy-2-methylbutyl)-1,2,4-triazolidine-3,5-dione |
| SMILES | CCC(C)(O)Cn1c(=O)[nH][nH]c1=O |
| InChI | InChI=1S/C7H13N3O3/c1-3-7(2,13)4-10-5(11)8-9-6(10)12/h13H,3-4H2,1-2H3,(H,8,11)(H,9,12) |
| InChIKey | JHDUDZHXAKKIQV-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |