C6H12N4O2 — CID 107410051
4-(2-amino-2-methylpropyl)-1,2,4-triazolidine-3,5-dione (PubChem CID 107410051) has the molecular formula C6H12N4O2 and a molecular weight of 172.19 g/mol. Its IUPAC name is 4-(2-amino-2-methylpropyl)-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-(2-amino-2-methylpropyl)-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 107410051 |
| Molecular Formula | C6H12N4O2 |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 4-(2-amino-2-methylpropyl)-1,2,4-triazolidine-3,5-dione |
| SMILES | CC(C)(N)Cn1c(=O)[nH][nH]c1=O |
| InChI | InChI=1S/C6H12N4O2/c1-6(2,7)3-10-4(11)8-9-5(10)12/h3,7H2,1-2H3,(H,8,11)(H,9,12) |
| InChIKey | UCXOWYOZVGGACX-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |