C13H21Cl2N3 — CID 113285541
1-N-[(3,6-dichloro-2-pyridinyl)methyl]-1-N,4-dimethylpentane-1,3-diamine (PubChem CID 113285541) has the molecular formula C13H21Cl2N3 and a molecular weight of 290.24 g/mol. Its IUPAC name is 1-N-[(3,6-dichloro-2-pyridinyl)methyl]-1-N,4-dimethylpentane-1,3-diamine.
| Compound Name | 1-N-[(3,6-dichloro-2-pyridinyl)methyl]-1-N,4-dimethylpentane-1,3-diamine |
|---|---|
| PubChem CID | 113285541 |
| Molecular Formula | C13H21Cl2N3 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 1-N-[(3,6-dichloro-2-pyridinyl)methyl]-1-N,4-dimethylpentane-1,3-diamine |
| SMILES | CC(C)C(N)CCN(C)Cc1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H21Cl2N3/c1-9(2)11(16)6-7-18(3)8-12-10(14)4-5-13(15)17-12/h4-5,9,11H,6-8,16H2,1-3H3 |
| InChIKey | PNTBPZYSLCYTMN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|