C13H21N3S2 — CID 113289225
N-ethyl-1-imidazo[2,1-b][1,3]thiazol-6-yl-3-propylsulfanylpropan-2-amine (PubChem CID 113289225) has the molecular formula C13H21N3S2 and a molecular weight of 283.47 g/mol. Its IUPAC name is N-ethyl-1-imidazo[2,1-b][1,3]thiazol-6-yl-3-propylsulfanylpropan-2-amine.
| Compound Name | N-ethyl-1-imidazo[2,1-b][1,3]thiazol-6-yl-3-propylsulfanylpropan-2-amine |
|---|---|
| PubChem CID | 113289225 |
| Molecular Formula | C13H21N3S2 |
| Molecular Weight | 283.47 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | N-ethyl-1-imidazo[2,1-b][1,3]thiazol-6-yl-3-propylsulfanylpropan-2-amine |
| SMILES | CCCSCC(Cc1cn2ccsc2n1)NCC |
| InChI | InChI=1S/C13H21N3S2/c1-3-6-17-10-12(14-4-2)8-11-9-16-5-7-18-13(16)15-11/h5,7,9,12,14H,3-4,6,8,10H2,1-2H3 |
| InChIKey | BXRUAQKCGZHHRO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|