C16H23N3S — CID 116661937
1-(cyclohexen-1-yl)-N-ethyl-3-imidazo[2,1-b][1,3]thiazol-6-ylpropan-2-amine (PubChem CID 116661937) has the molecular formula C16H23N3S and a molecular weight of 289.45 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-N-ethyl-3-imidazo[2,1-b][1,3]thiazol-6-ylpropan-2-amine.
| Compound Name | 1-(cyclohexen-1-yl)-N-ethyl-3-imidazo[2,1-b][1,3]thiazol-6-ylpropan-2-amine |
|---|---|
| PubChem CID | 116661937 |
| Molecular Formula | C16H23N3S |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 1-(cyclohexen-1-yl)-N-ethyl-3-imidazo[2,1-b][1,3]thiazol-6-ylpropan-2-amine |
| SMILES | CCNC(CC1=CCCCC1)Cc1cn2ccsc2n1 |
| InChI | InChI=1S/C16H23N3S/c1-2-17-14(10-13-6-4-3-5-7-13)11-15-12-19-8-9-20-16(19)18-15/h6,8-9,12,14,17H,2-5,7,10-11H2,1H3 |
| InChIKey | WFLRSVXEISYRBC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|