C12H15F4NO — CID 113292116
3-(ethylamino)-3-[3-fluoro-5-(trifluoromethyl)phenyl]propan-1-ol (PubChem CID 113292116) has the molecular formula C12H15F4NO and a molecular weight of 265.25 g/mol. Its IUPAC name is 3-(ethylamino)-3-[3-fluoro-5-(trifluoromethyl)phenyl]propan-1-ol.
| Compound Name | 3-(ethylamino)-3-[3-fluoro-5-(trifluoromethyl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 113292116 |
| Molecular Formula | C12H15F4NO |
| Molecular Weight | 265.25 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 3-(ethylamino)-3-[3-fluoro-5-(trifluoromethyl)phenyl]propan-1-ol |
| SMILES | CCNC(CCO)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H15F4NO/c1-2-17-11(3-4-18)8-5-9(12(14,15)16)7-10(13)6-8/h5-7,11,17-18H,2-4H2,1H3 |
| InChIKey | RYQMDWGBKMPVOT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |