C13H18F4N2O — CID 83176675
3-[[2-amino-1-[3-fluoro-5-(trifluoromethyl)phenyl]ethyl]amino]butan-1-ol (PubChem CID 83176675) has the molecular formula C13H18F4N2O and a molecular weight of 294.29 g/mol. Its IUPAC name is 3-[[2-amino-1-[3-fluoro-5-(trifluoromethyl)phenyl]ethyl]amino]butan-1-ol.
| Compound Name | 3-[[2-amino-1-[3-fluoro-5-(trifluoromethyl)phenyl]ethyl]amino]butan-1-ol |
|---|---|
| PubChem CID | 83176675 |
| Molecular Formula | C13H18F4N2O |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 3-[[2-amino-1-[3-fluoro-5-(trifluoromethyl)phenyl]ethyl]amino]butan-1-ol |
| SMILES | CC(CCO)NC(CN)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H18F4N2O/c1-8(2-3-20)19-12(7-18)9-4-10(13(15,16)17)6-11(14)5-9/h4-6,8,12,19-20H,2-3,7,18H2,1H3 |
| InChIKey | XOXNLEITFIKMEI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |