C15H21N3 — CID 113301219
4-tert-butyl-3-(2,4,6-trimethylphenyl)-1,2,4-triazole (PubChem CID 113301219) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 4-tert-butyl-3-(2,4,6-trimethylphenyl)-1,2,4-triazole.
| Compound Name | 4-tert-butyl-3-(2,4,6-trimethylphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 113301219 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 4-tert-butyl-3-(2,4,6-trimethylphenyl)-1,2,4-triazole |
| SMILES | Cc1cc(C)c(-c2nncn2C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C15H21N3/c1-10-7-11(2)13(12(3)8-10)14-17-16-9-18(14)15(4,5)6/h7-9H,1-6H3 |
| InChIKey | ISYQQLOBELKIBT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |