C14H19N3 — CID 113301166
4-tert-butyl-3-(2,4-dimethylphenyl)-1,2,4-triazole (PubChem CID 113301166) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 4-tert-butyl-3-(2,4-dimethylphenyl)-1,2,4-triazole.
| Compound Name | 4-tert-butyl-3-(2,4-dimethylphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 113301166 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 4-tert-butyl-3-(2,4-dimethylphenyl)-1,2,4-triazole |
| SMILES | Cc1ccc(-c2nncn2C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C14H19N3/c1-10-6-7-12(11(2)8-10)13-16-15-9-17(13)14(3,4)5/h6-9H,1-5H3 |
| InChIKey | FZNDTNYMMMZOQC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |