C16H19ClN2 — CID 43557888
4-tert-butyl-6-chloro-2-(2,4-dimethylphenyl)pyrimidine (PubChem CID 43557888) has the molecular formula C16H19ClN2 and a molecular weight of 274.80 g/mol. Its IUPAC name is 4-tert-butyl-6-chloro-2-(2,4-dimethylphenyl)pyrimidine.
| Compound Name | 4-tert-butyl-6-chloro-2-(2,4-dimethylphenyl)pyrimidine |
|---|---|
| PubChem CID | 43557888 |
| Molecular Formula | C16H19ClN2 |
| Molecular Weight | 274.80 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 4-tert-butyl-6-chloro-2-(2,4-dimethylphenyl)pyrimidine |
| SMILES | Cc1ccc(-c2nc(Cl)cc(C(C)(C)C)n2)c(C)c1 |
| InChI | InChI=1S/C16H19ClN2/c1-10-6-7-12(11(2)8-10)15-18-13(16(3,4)5)9-14(17)19-15/h6-9H,1-5H3 |
| InChIKey | ILPMCDRECHROSZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.80 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |