C28H27N2V- — CID 58604237
2,4,6-tris(2,4-dimethylphenyl)-5H-pyrimidin-5-ide;vanadium (PubChem CID 58604237) has the molecular formula C28H27N2V- and a molecular weight of 442.48 g/mol. Its IUPAC name is 2,4,6-tris(2,4-dimethylphenyl)-5H-pyrimidin-5-ide;vanadium.
| Compound Name | 2,4,6-tris(2,4-dimethylphenyl)-5H-pyrimidin-5-ide;vanadium |
|---|---|
| PubChem CID | 58604237 |
| Molecular Formula | C28H27N2V- |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 2,4,6-tris(2,4-dimethylphenyl)-5H-pyrimidin-5-ide;vanadium |
| SMILES | Cc1ccc(-c2[c-]c(-c3ccc(C)cc3C)nc(-c3ccc(C)cc3C)n2)c(C)c1.[V] |
| InChI | InChI=1S/C28H27N2.V/c1-17-7-10-23(20(4)13-17)26-16-27(24-11-8-18(2)14-21(24)5)30-28(29-26)25-12-9-19(3)15-22(25)6;/h7-15H,1-6H3;/q-1; |
| InChIKey | WKNTVYFWYJRKDR-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|