C27H21IO3S — CID 11330320
(2S,3R)-2-(4-iodophenyl)-3-(3-phenylmethoxyphenyl)-2,3-dihydro-1,4-benzoxathiin-6-ol (PubChem CID 11330320) has the molecular formula C27H21IO3S and a molecular weight of 552.43 g/mol. Its IUPAC name is (2S,3R)-2-(4-iodophenyl)-3-(3-phenylmethoxyphenyl)-2,3-dihydro-1,4-benzoxathiin-6-ol.
| Compound Name | (2S,3R)-2-(4-iodophenyl)-3-(3-phenylmethoxyphenyl)-2,3-dihydro-1,4-benzoxathiin-6-ol |
|---|---|
| PubChem CID | 11330320 |
| Molecular Formula | C27H21IO3S |
| Molecular Weight | 552.43 g/mol |
| Exact Mass | 552.03 |
| IUPAC Name | (2S,3R)-2-(4-iodophenyl)-3-(3-phenylmethoxyphenyl)-2,3-dihydro-1,4-benzoxathiin-6-ol |
| SMILES | Oc1ccc2c(c1)S[C@H](c1cccc(OCc3ccccc3)c1)[C@H](c1ccc(I)cc1)O2 |
| InChI | InChI=1S/C27H21IO3S/c28-21-11-9-19(10-12-21)26-27(32-25-16-22(29)13-14-24(25)31-26)20-7-4-8-23(15-20)30-17-18-5-2-1-3-6-18/h1-16,26-27,29H,17H2/t26-,27+/m0/s1 |
| InChIKey | ORIXLHPKUOSKMH-RRPNLBNLSA-N |
| XLogP | 7.54 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.43 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|