C21H19IO2S — CID 11271176
(1S,2R)-1-(4-iodophenyl)-2-(3-phenylmethoxyphenyl)-2-sulfanylethanol (PubChem CID 11271176) has the molecular formula C21H19IO2S and a molecular weight of 462.35 g/mol. Its IUPAC name is (1S,2R)-1-(4-iodophenyl)-2-(3-phenylmethoxyphenyl)-2-sulfanylethanol.
| Compound Name | (1S,2R)-1-(4-iodophenyl)-2-(3-phenylmethoxyphenyl)-2-sulfanylethanol |
|---|---|
| PubChem CID | 11271176 |
| Molecular Formula | C21H19IO2S |
| Molecular Weight | 462.35 g/mol |
| Exact Mass | 462.02 |
| IUPAC Name | (1S,2R)-1-(4-iodophenyl)-2-(3-phenylmethoxyphenyl)-2-sulfanylethanol |
| SMILES | O[C@@H](c1ccc(I)cc1)[C@H](S)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C21H19IO2S/c22-18-11-9-16(10-12-18)20(23)21(25)17-7-4-8-19(13-17)24-14-15-5-2-1-3-6-15/h1-13,20-21,23,25H,14H2/t20-,21+/m0/s1 |
| InChIKey | FXAQTFOESPTYTK-LEWJYISDSA-N |
| XLogP | 5.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.35 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|