C12H11N5O — CID 113305042
5-methoxy-2-([1,2,4]triazolo[4,3-a]pyrazin-3-yl)aniline (PubChem CID 113305042) has the molecular formula C12H11N5O and a molecular weight of 241.25 g/mol. Its IUPAC name is 5-methoxy-2-([1,2,4]triazolo[4,3-a]pyrazin-3-yl)aniline.
| Compound Name | 5-methoxy-2-([1,2,4]triazolo[4,3-a]pyrazin-3-yl)aniline |
|---|---|
| PubChem CID | 113305042 |
| Molecular Formula | C12H11N5O |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 5-methoxy-2-([1,2,4]triazolo[4,3-a]pyrazin-3-yl)aniline |
| SMILES | COc1ccc(-c2nnc3cnccn23)c(N)c1 |
| InChI | InChI=1S/C12H11N5O/c1-18-8-2-3-9(10(13)6-8)12-16-15-11-7-14-4-5-17(11)12/h2-7H,13H2,1H3 |
| InChIKey | BSNGMPMHGZUZNY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|