C38H45N3O9 — CID 11331420
(2S)-6-[(7-methoxy-7-oxoheptanoyl)-phenylmethoxyamino]-2-[[(4S)-2-(2-phenylmethoxyphenyl)-4,5-dihydro-1,3-oxazole-4-carbonyl]amino]hexanoic acid (PubChem CID 11331420) has the molecular formula C38H45N3O9 and a molecular weight of 687.79 g/mol. Its IUPAC name is (2S)-6-[(7-methoxy-7-oxoheptanoyl)-phenylmethoxyamino]-2-[[(4S)-2-(2-phenylmethoxyphenyl)-4,5-dihydro-1,3-oxazole-4-carbonyl]amino]hexanoic acid.
| Compound Name | (2S)-6-[(7-methoxy-7-oxoheptanoyl)-phenylmethoxyamino]-2-[[(4S)-2-(2-phenylmethoxyphenyl)-4,5-dihydro-1,3-oxazole-4-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 11331420 |
| Molecular Formula | C38H45N3O9 |
| Molecular Weight | 687.79 g/mol |
| Exact Mass | 687.32 |
| IUPAC Name | (2S)-6-[(7-methoxy-7-oxoheptanoyl)-phenylmethoxyamino]-2-[[(4S)-2-(2-phenylmethoxyphenyl)-4,5-dihydro-1,3-oxazole-4-carbonyl]amino]hexanoic acid |
| SMILES | COC(=O)CCCCCC(=O)N(CCCC[C@H](NC(=O)[C@@H]1COC(c2ccccc2OCc2ccccc2)=N1)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C38H45N3O9/c1-47-35(43)23-10-4-9-22-34(42)41(50-26-29-17-7-3-8-18-29)24-14-13-20-31(38(45)46)39-36(44)32-27-49-37(40-32)30-19-11-12-21-33(30)48-25-28-15-5-2-6-16-28/h2-3,5-8,11-12,15-19,21,31-32H,4,9-10,13-14,20,22-27H2,1H3,(H,39,44)(H,45,46)/t31-,32-/m0/s1 |
| InChIKey | PBOFPWYPYAXIEB-ACHIHNKUSA-N |
| XLogP | 5.23 |
| TPSA | 153.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.79 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|