C13H10O4S — CID 113318466
5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)furan-2-carbaldehyde (PubChem CID 113318466) has the molecular formula C13H10O4S and a molecular weight of 262.29 g/mol. Its IUPAC name is 5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)furan-2-carbaldehyde.
| Compound Name | 5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)furan-2-carbaldehyde |
|---|---|
| PubChem CID | 113318466 |
| Molecular Formula | C13H10O4S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(Sc2ccc3c(c2)OCCO3)o1 |
| InChI | InChI=1S/C13H10O4S/c14-8-9-1-4-13(17-9)18-10-2-3-11-12(7-10)16-6-5-15-11/h1-4,7-8H,5-6H2 |
| InChIKey | STIFBERLAYGZOX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|