C13H10ClNO3S2 — CID 115280332
4-chloro-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)-1,3-thiazole-5-carbaldehyde (PubChem CID 115280332) has the molecular formula C13H10ClNO3S2 and a molecular weight of 327.81 g/mol. Its IUPAC name is 4-chloro-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)-1,3-thiazole-5-carbaldehyde.
| Compound Name | 4-chloro-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 115280332 |
| Molecular Formula | C13H10ClNO3S2 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 326.98 |
| IUPAC Name | 4-chloro-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1sc(Sc2ccc3c(c2)OCCCO3)nc1Cl |
| InChI | InChI=1S/C13H10ClNO3S2/c14-12-11(7-16)20-13(15-12)19-8-2-3-9-10(6-8)18-5-1-4-17-9/h2-3,6-7H,1,4-5H2 |
| InChIKey | ZTPKXYXAUUQWEB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|