C54H40F6N4O6S2 — CID 11332156
4-[4-[4-[1-(4-aminophenyl)-2,6-diphenylpyridin-1-ium-4-yl]phenyl]-2,6-diphenylpyridin-1-ium-1-yl]aniline;bis(trifluoromethanesulfonate) (PubChem CID 11332156) has the molecular formula C54H40F6N4O6S2 and a molecular weight of 1019.06 g/mol. Its IUPAC name is 4-[4-[4-[1-(4-aminophenyl)-2,6-diphenylpyridin-1-ium-4-yl]phenyl]-2,6-diphenylpyridin-1-ium-1-yl]aniline;bis(trifluoromethanesulfonate).
| Compound Name | 4-[4-[4-[1-(4-aminophenyl)-2,6-diphenylpyridin-1-ium-4-yl]phenyl]-2,6-diphenylpyridin-1-ium-1-yl]aniline;bis(trifluoromethanesulfonate) |
|---|---|
| PubChem CID | 11332156 |
| Molecular Formula | C54H40F6N4O6S2 |
| Molecular Weight | 1019.06 g/mol |
| Exact Mass | 1018.23 |
| IUPAC Name | 4-[4-[4-[1-(4-aminophenyl)-2,6-diphenylpyridin-1-ium-4-yl]phenyl]-2,6-diphenylpyridin-1-ium-1-yl]aniline;bis(trifluoromethanesulfonate) |
| SMILES | Nc1ccc(-[n+]2c(-c3ccccc3)cc(-c3ccc(-c4cc(-c5ccccc5)[n+](-c5ccc(N)cc5)c(-c5ccccc5)c4)cc3)cc2-c2ccccc2)cc1.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C52H39N4.2CHF3O3S/c53-45-25-29-47(30-26-45)55-49(39-13-5-1-6-14-39)33-43(34-50(55)40-15-7-2-8-16-40)37-21-23-38(24-22-37)44-35-51(41-17-9-3-10-18-41)56(48-31-27-46(54)28-32-48)52(36-44)42-19-11-4-12-20-42;2*2-1(3,4)8(5,6)7/h1-36,53H,54H2;2*(H,5,6,7)/q+1;;/p-1 |
| InChIKey | GJBPYJPBQULTCB-UHFFFAOYSA-M |
| XLogP | 11.51 |
| TPSA | 174.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1019.06 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|