C48H57F3InN3O3S — CID 139115279
N-(2,5-ditert-butylphenyl)-1-[6-[N-(2,5-ditert-butylphenyl)-C-phenylcarbonimidoyl]-2-pyridinyl]-1-phenylmethanimine;indium(1+);trifluoromethanesulfonate (PubChem CID 139115279) has the molecular formula C48H57F3InN3O3S and a molecular weight of 927.88 g/mol. Its IUPAC name is N-(2,5-ditert-butylphenyl)-1-[6-[N-(2,5-ditert-butylphenyl)-C-phenylcarbonimidoyl]-2-pyridinyl]-1-phenylmethanimine;indium(1+);trifluoromethanesulfonate.
| Compound Name | N-(2,5-ditert-butylphenyl)-1-[6-[N-(2,5-ditert-butylphenyl)-C-phenylcarbonimidoyl]-2-pyridinyl]-1-phenylmethanimine;indium(1+);trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139115279 |
| Molecular Formula | C48H57F3InN3O3S |
| Molecular Weight | 927.88 g/mol |
| Exact Mass | 927.31 |
| IUPAC Name | N-(2,5-ditert-butylphenyl)-1-[6-[N-(2,5-ditert-butylphenyl)-C-phenylcarbonimidoyl]-2-pyridinyl]-1-phenylmethanimine;indium(1+);trifluoromethanesulfonate |
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)c(/N=C(\c2ccccc2)c2cccc(/C(=N/c3cc(C(C)(C)C)ccc3C(C)(C)C)c3ccccc3)n2)c1.O=S(=O)([O-])C(F)(F)F.[InH2+] |
| InChI | InChI=1S/C47H55N3.CHF3O3S.In.2H/c1-44(2,3)34-26-28-36(46(7,8)9)40(30-34)49-42(32-20-15-13-16-21-32)38-24-19-25-39(48-38)43(33-22-17-14-18-23-33)50-41-31-35(45(4,5)6)27-29-37(41)47(10,11)12;2-1(3,4)8(5,6)7;;;/h13-31H,1-12H3;(H,5,6,7);;;/q;;+1;;/p-1/b49-42+,50-43+;;;; |
| InChIKey | PUWGZFUAAIHCLB-FXYDQJJISA-M |
| XLogP | 11.74 |
| TPSA | 94.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 927.88 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|