C40H41F3InN3O3S — CID 139132664
N-(2,6-diethylphenyl)-1-[6-[N-(2,6-diethylphenyl)-C-phenylcarbonimidoyl]-2-pyridinyl]-1-phenylmethanimine;indium(1+);trifluoromethanesulfonate (PubChem CID 139132664) has the molecular formula C40H41F3InN3O3S and a molecular weight of 815.67 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-1-[6-[N-(2,6-diethylphenyl)-C-phenylcarbonimidoyl]-2-pyridinyl]-1-phenylmethanimine;indium(1+);trifluoromethanesulfonate.
| Compound Name | N-(2,6-diethylphenyl)-1-[6-[N-(2,6-diethylphenyl)-C-phenylcarbonimidoyl]-2-pyridinyl]-1-phenylmethanimine;indium(1+);trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139132664 |
| Molecular Formula | C40H41F3InN3O3S |
| Molecular Weight | 815.67 g/mol |
| Exact Mass | 815.19 |
| IUPAC Name | N-(2,6-diethylphenyl)-1-[6-[N-(2,6-diethylphenyl)-C-phenylcarbonimidoyl]-2-pyridinyl]-1-phenylmethanimine;indium(1+);trifluoromethanesulfonate |
| SMILES | CCc1cccc(CC)c1/N=C(\c1ccccc1)c1cccc(/C(=N/c2c(CC)cccc2CC)c2ccccc2)n1.O=S(=O)([O-])C(F)(F)F.[InH2+] |
| InChI | InChI=1S/C39H39N3.CHF3O3S.In.2H/c1-5-28-22-15-23-29(6-2)36(28)41-38(32-18-11-9-12-19-32)34-26-17-27-35(40-34)39(33-20-13-10-14-21-33)42-37-30(7-3)24-16-25-31(37)8-4;2-1(3,4)8(5,6)7;;;/h9-27H,5-8H2,1-4H3;(H,5,6,7);;;/q;;+1;;/p-1/b41-38+,42-39+;;;; |
| InChIKey | RQUVVRWHJGNLGL-KYDFLBLMSA-M |
| XLogP | 8.80 |
| TPSA | 94.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.67 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|