C11H10ClN3O3 — CID 113346470
4-chloro-2-hydroxy-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]benzamide (PubChem CID 113346470) has the molecular formula C11H10ClN3O3 and a molecular weight of 267.67 g/mol. Its IUPAC name is 4-chloro-2-hydroxy-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]benzamide.
| Compound Name | 4-chloro-2-hydroxy-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 113346470 |
| Molecular Formula | C11H10ClN3O3 |
| Molecular Weight | 267.67 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 4-chloro-2-hydroxy-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]benzamide |
| SMILES | O=C(NCCc1ncon1)c1ccc(Cl)cc1O |
| InChI | InChI=1S/C11H10ClN3O3/c12-7-1-2-8(9(16)5-7)11(17)13-4-3-10-14-6-18-15-10/h1-2,5-6,16H,3-4H2,(H,13,17) |
| InChIKey | OFLQIZKBQWKJEO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.67 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |