C14H11ClN4O2 — CID 106396198
4-chloro-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]quinoline-2-carboxamide (PubChem CID 106396198) has the molecular formula C14H11ClN4O2 and a molecular weight of 302.72 g/mol. Its IUPAC name is 4-chloro-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]quinoline-2-carboxamide.
| Compound Name | 4-chloro-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 106396198 |
| Molecular Formula | C14H11ClN4O2 |
| Molecular Weight | 302.72 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 4-chloro-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]quinoline-2-carboxamide |
| SMILES | O=C(NCCc1ncon1)c1cc(Cl)c2ccccc2n1 |
| InChI | InChI=1S/C14H11ClN4O2/c15-10-7-12(18-11-4-2-1-3-9(10)11)14(20)16-6-5-13-17-8-21-19-13/h1-4,7-8H,5-6H2,(H,16,20) |
| InChIKey | USHQVJTUYJOYAP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.72 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |