C15H22N2 — CID 113346785
5-(2,3-dimethylanilino)-4,4-dimethylpentanenitrile (PubChem CID 113346785) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 5-(2,3-dimethylanilino)-4,4-dimethylpentanenitrile.
| Compound Name | 5-(2,3-dimethylanilino)-4,4-dimethylpentanenitrile |
|---|---|
| PubChem CID | 113346785 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 5-(2,3-dimethylanilino)-4,4-dimethylpentanenitrile |
| SMILES | Cc1cccc(NCC(C)(C)CCC#N)c1C |
| InChI | InChI=1S/C15H22N2/c1-12-7-5-8-14(13(12)2)17-11-15(3,4)9-6-10-16/h5,7-8,17H,6,9,11H2,1-4H3 |
| InChIKey | QSPOQCYBMZIUPU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |