C13H14N2O3S — CID 11334929
4-isocyanato-N,N-bis(prop-2-enyl)benzenesulfonamide (PubChem CID 11334929) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is 4-isocyanato-N,N-bis(prop-2-enyl)benzenesulfonamide.
| Compound Name | 4-isocyanato-N,N-bis(prop-2-enyl)benzenesulfonamide |
|---|---|
| PubChem CID | 11334929 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 4-isocyanato-N,N-bis(prop-2-enyl)benzenesulfonamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(N=C=O)cc1 |
| InChI | InChI=1S/C13H14N2O3S/c1-3-9-15(10-4-2)19(17,18)13-7-5-12(6-8-13)14-11-16/h3-8H,1-2,9-10H2 |
| InChIKey | VOSRPKXWFWLWTM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|