C15H22O3S — CID 11335052
(E,2R,5S)-5-(benzenesulfonyl)-6,6-dimethylhept-3-en-2-ol (PubChem CID 11335052) has the molecular formula C15H22O3S and a molecular weight of 282.41 g/mol. Its IUPAC name is (E,2R,5S)-5-(benzenesulfonyl)-6,6-dimethylhept-3-en-2-ol.
| Compound Name | (E,2R,5S)-5-(benzenesulfonyl)-6,6-dimethylhept-3-en-2-ol |
|---|---|
| PubChem CID | 11335052 |
| Molecular Formula | C15H22O3S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | (E,2R,5S)-5-(benzenesulfonyl)-6,6-dimethylhept-3-en-2-ol |
| SMILES | C[C@@H](O)/C=C/[C@@H](C(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H22O3S/c1-12(16)10-11-14(15(2,3)4)19(17,18)13-8-6-5-7-9-13/h5-12,14,16H,1-4H3/b11-10+/t12-,14+/m1/s1 |
| InChIKey | KBLFLEAJTVDCRY-DISFZNMFSA-N |
| XLogP | 2.81 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|