C15H13F2NO — CID 113365493
2-(2,5-difluorophenyl)-1-(3,5-dimethyl-2-pyridinyl)ethanone (PubChem CID 113365493) has the molecular formula C15H13F2NO and a molecular weight of 261.27 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-1-(3,5-dimethyl-2-pyridinyl)ethanone.
| Compound Name | 2-(2,5-difluorophenyl)-1-(3,5-dimethyl-2-pyridinyl)ethanone |
|---|---|
| PubChem CID | 113365493 |
| Molecular Formula | C15H13F2NO |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-(2,5-difluorophenyl)-1-(3,5-dimethyl-2-pyridinyl)ethanone |
| SMILES | Cc1cnc(C(=O)Cc2cc(F)ccc2F)c(C)c1 |
| InChI | InChI=1S/C15H13F2NO/c1-9-5-10(2)15(18-8-9)14(19)7-11-6-12(16)3-4-13(11)17/h3-6,8H,7H2,1-2H3 |
| InChIKey | MYULBBRYRCMBLN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |