C15H17ClN2S — CID 113373715
5-(chloromethyl)-2-(2,3-dihydro-1H-inden-5-ylmethylsulfanyl)-1-methylimidazole (PubChem CID 113373715) has the molecular formula C15H17ClN2S and a molecular weight of 292.84 g/mol. Its IUPAC name is 5-(chloromethyl)-2-(2,3-dihydro-1H-inden-5-ylmethylsulfanyl)-1-methylimidazole.
| Compound Name | 5-(chloromethyl)-2-(2,3-dihydro-1H-inden-5-ylmethylsulfanyl)-1-methylimidazole |
|---|---|
| PubChem CID | 113373715 |
| Molecular Formula | C15H17ClN2S |
| Molecular Weight | 292.84 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 5-(chloromethyl)-2-(2,3-dihydro-1H-inden-5-ylmethylsulfanyl)-1-methylimidazole |
| SMILES | Cn1c(CCl)cnc1SCc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H17ClN2S/c1-18-14(8-16)9-17-15(18)19-10-11-5-6-12-3-2-4-13(12)7-11/h5-7,9H,2-4,8,10H2,1H3 |
| InChIKey | VXSQTZSJKRRRHW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.84 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|