C11H10N6S — CID 113384290
4-[1-(5-methyl-1,3,4-thiadiazol-2-yl)-1,2,4-triazol-3-yl]aniline (PubChem CID 113384290) has the molecular formula C11H10N6S and a molecular weight of 258.31 g/mol. Its IUPAC name is 4-[1-(5-methyl-1,3,4-thiadiazol-2-yl)-1,2,4-triazol-3-yl]aniline.
| Compound Name | 4-[1-(5-methyl-1,3,4-thiadiazol-2-yl)-1,2,4-triazol-3-yl]aniline |
|---|---|
| PubChem CID | 113384290 |
| Molecular Formula | C11H10N6S |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 4-[1-(5-methyl-1,3,4-thiadiazol-2-yl)-1,2,4-triazol-3-yl]aniline |
| SMILES | Cc1nnc(-n2cnc(-c3ccc(N)cc3)n2)s1 |
| InChI | InChI=1S/C11H10N6S/c1-7-14-15-11(18-7)17-6-13-10(16-17)8-2-4-9(12)5-3-8/h2-6H,12H2,1H3 |
| InChIKey | VYBLNBVIUIKODM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|