About 2-(5-methyl-1,3,4-thiadiazol-2-yl)pyrazol-3-amine
2-(5-methyl-1,3,4-thiadiazol-2-yl)pyrazol-3-amine (PubChem CID 66490603) has the molecular formula C6H7N5S
and a molecular weight of 181.22 g/mol. Its IUPAC name is 2-(5-methyl-1,3,4-thiadiazol-2-yl)pyrazol-3-amine.
Analyze 2-(5-methyl-1,3,4-thiadiazol-2-yl)pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methyl-1,3,4-thiadiazol-2-yl)pyrazol-3-amine?
The IUPAC name of 2-(5-methyl-1,3,4-thiadiazol-2-yl)pyrazol-3-amine (CID 66490603) is 2-(5-methyl-1,3,4-thiadiazol-2-yl)pyrazol-3-amine.
What is the SMILES notation for 2-(5-methyl-1,3,4-thiadiazol-2-yl)pyrazol-3-amine?
The canonical SMILES for 2-(5-methyl-1,3,4-thiadiazol-2-yl)pyrazol-3-amine is Cc1nnc(-n2nccc2N)s1.
What is the InChIKey of 2-(5-methyl-1,3,4-thiadiazol-2-yl)pyrazol-3-amine?
The InChIKey is PZEVLPPMCYPVBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5S/c1-4-9-10-6(12-4)11-5(7)2-3-8-11/h2-3H,7H2,1H3.
What are the key properties of 2-(5-methyl-1,3,4-thiadiazol-2-yl)pyrazol-3-amine?
2-(5-methyl-1,3,4-thiadiazol-2-yl)pyrazol-3-amine has a molecular weight of 181.22 g/mol, XLogP of 0.61, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methyl-1,3,4-thiadiazol-2-yl)pyrazol-3-amine is sourced from PubChem (CID 66490603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).