C6H5BrN4S — CID 65208447
2-(4-bromopyrazol-1-yl)-5-methyl-1,3,4-thiadiazole (PubChem CID 65208447) has the molecular formula C6H5BrN4S and a molecular weight of 245.11 g/mol. Its IUPAC name is 2-(4-bromopyrazol-1-yl)-5-methyl-1,3,4-thiadiazole.
| Compound Name | 2-(4-bromopyrazol-1-yl)-5-methyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 65208447 |
| Molecular Formula | C6H5BrN4S |
| Molecular Weight | 245.11 g/mol |
| Exact Mass | 243.94 |
| IUPAC Name | 2-(4-bromopyrazol-1-yl)-5-methyl-1,3,4-thiadiazole |
| SMILES | Cc1nnc(-n2cc(Br)cn2)s1 |
| InChI | InChI=1S/C6H5BrN4S/c1-4-9-10-6(12-4)11-3-5(7)2-8-11/h2-3H,1H3 |
| InChIKey | MXEPBCBFBFSVSG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.11 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |