C14H16BrNO2 — CID 113384462
4-bromo-N-(2,2-dimethoxyethyl)naphthalen-1-amine (PubChem CID 113384462) has the molecular formula C14H16BrNO2 and a molecular weight of 310.19 g/mol. Its IUPAC name is 4-bromo-N-(2,2-dimethoxyethyl)naphthalen-1-amine.
| Compound Name | 4-bromo-N-(2,2-dimethoxyethyl)naphthalen-1-amine |
|---|---|
| PubChem CID | 113384462 |
| Molecular Formula | C14H16BrNO2 |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 4-bromo-N-(2,2-dimethoxyethyl)naphthalen-1-amine |
| SMILES | COC(CNc1ccc(Br)c2ccccc12)OC |
| InChI | InChI=1S/C14H16BrNO2/c1-17-14(18-2)9-16-13-8-7-12(15)10-5-3-4-6-11(10)13/h3-8,14,16H,9H2,1-2H3 |
| InChIKey | XCXTYFQOLRKYRI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|