About 5-chloro-4-(chloromethyl)-1,3-dicyclopentylpyrazole
5-chloro-4-(chloromethyl)-1,3-dicyclopentylpyrazole (PubChem CID 113390064) has the molecular formula C14H20Cl2N2
and a molecular weight of 287.23 g/mol. Its IUPAC name is 5-chloro-4-(chloromethyl)-1,3-dicyclopentylpyrazole.
Molecular Properties
| Compound Name | 5-chloro-4-(chloromethyl)-1,3-dicyclopentylpyrazole |
| PubChem CID | 113390064 |
| Molecular Formula | C14H20Cl2N2 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 5-chloro-4-(chloromethyl)-1,3-dicyclopentylpyrazole |
| SMILES | ClCc1c(C2CCCC2)nn(C2CCCC2)c1Cl |
| InChI | InChI=1S/C14H20Cl2N2/c15-9-12-13(10-5-1-2-6-10)17-18(14(12)16)11-7-3-4-8-11/h10-11H,1-9H2 |
| InChIKey | GITKCCUYYOWHHJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-4-(chloromethyl)-1,3-dicyclopentylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-(chloromethyl)-1,3-dicyclopentylpyrazole?
The IUPAC name of 5-chloro-4-(chloromethyl)-1,3-dicyclopentylpyrazole (CID 113390064) is 5-chloro-4-(chloromethyl)-1,3-dicyclopentylpyrazole.
What is the SMILES notation for 5-chloro-4-(chloromethyl)-1,3-dicyclopentylpyrazole?
The canonical SMILES for 5-chloro-4-(chloromethyl)-1,3-dicyclopentylpyrazole is ClCc1c(C2CCCC2)nn(C2CCCC2)c1Cl.
What is the InChIKey of 5-chloro-4-(chloromethyl)-1,3-dicyclopentylpyrazole?
The InChIKey is GITKCCUYYOWHHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20Cl2N2/c15-9-12-13(10-5-1-2-6-10)17-18(14(12)16)11-7-3-4-8-11/h10-11H,1-9H2.
What are the key properties of 5-chloro-4-(chloromethyl)-1,3-dicyclopentylpyrazole?
5-chloro-4-(chloromethyl)-1,3-dicyclopentylpyrazole has a molecular weight of 287.23 g/mol, XLogP of 5.05, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-(chloromethyl)-1,3-dicyclopentylpyrazole is sourced from PubChem (CID 113390064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).