C14H20Cl2N2 — CID 113390064
5-chloro-4-(chloromethyl)-1,3-dicyclopentylpyrazole (PubChem CID 113390064) has the molecular formula C14H20Cl2N2 and a molecular weight of 287.23 g/mol. Its IUPAC name is 5-chloro-4-(chloromethyl)-1,3-dicyclopentylpyrazole.
| Compound Name | 5-chloro-4-(chloromethyl)-1,3-dicyclopentylpyrazole |
|---|---|
| PubChem CID | 113390064 |
| Molecular Formula | C14H20Cl2N2 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 5-chloro-4-(chloromethyl)-1,3-dicyclopentylpyrazole |
| SMILES | ClCc1c(C2CCCC2)nn(C2CCCC2)c1Cl |
| InChI | InChI=1S/C14H20Cl2N2/c15-9-12-13(10-5-1-2-6-10)17-18(14(12)16)11-7-3-4-8-11/h10-11H,1-9H2 |
| InChIKey | GITKCCUYYOWHHJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|