C12H20ClFN2 — CID 82700633
4-(1-chloropropyl)-3,5-diethyl-1-(2-fluoroethyl)pyrazole (PubChem CID 82700633) has the molecular formula C12H20ClFN2 and a molecular weight of 246.76 g/mol. Its IUPAC name is 4-(1-chloropropyl)-3,5-diethyl-1-(2-fluoroethyl)pyrazole.
| Compound Name | 4-(1-chloropropyl)-3,5-diethyl-1-(2-fluoroethyl)pyrazole |
|---|---|
| PubChem CID | 82700633 |
| Molecular Formula | C12H20ClFN2 |
| Molecular Weight | 246.76 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 4-(1-chloropropyl)-3,5-diethyl-1-(2-fluoroethyl)pyrazole |
| SMILES | CCc1nn(CCF)c(CC)c1C(Cl)CC |
| InChI | InChI=1S/C12H20ClFN2/c1-4-9(13)12-10(5-2)15-16(8-7-14)11(12)6-3/h9H,4-8H2,1-3H3 |
| InChIKey | AWMYRCDKBNKLEM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.76 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|