C15H21ClN2 — CID 113395022
N-(2-chlorocycloheptyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-2-amine (PubChem CID 113395022) has the molecular formula C15H21ClN2 and a molecular weight of 264.80 g/mol. Its IUPAC name is N-(2-chlorocycloheptyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-2-amine.
| Compound Name | N-(2-chlorocycloheptyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-2-amine |
|---|---|
| PubChem CID | 113395022 |
| Molecular Formula | C15H21ClN2 |
| Molecular Weight | 264.80 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | N-(2-chlorocycloheptyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-2-amine |
| SMILES | ClC1CCCCCC1Nc1ccc2c(n1)CCC2 |
| InChI | InChI=1S/C15H21ClN2/c16-12-6-2-1-3-7-14(12)18-15-10-9-11-5-4-8-13(11)17-15/h9-10,12,14H,1-8H2,(H,17,18) |
| InChIKey | MMIGEOSFTQMSFB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.80 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|