C13H21N3OS — CID 113399548
2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-ol (PubChem CID 113399548) has the molecular formula C13H21N3OS and a molecular weight of 267.40 g/mol. Its IUPAC name is 2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-ol.
| Compound Name | 2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-ol |
|---|---|
| PubChem CID | 113399548 |
| Molecular Formula | C13H21N3OS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 2-[[2-(ethylamino)-1,3-thiazol-5-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-ol |
| SMILES | CCNc1ncc(CN2CC3CCC(O)C3C2)s1 |
| InChI | InChI=1S/C13H21N3OS/c1-2-14-13-15-5-10(18-13)7-16-6-9-3-4-12(17)11(9)8-16/h5,9,11-12,17H,2-4,6-8H2,1H3,(H,14,15) |
| InChIKey | CSKWSQHMLRMWLK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |