C13H11NO2S2 — CID 113403944
N-[4-(5-formylthiophen-2-yl)sulfanylphenyl]acetamide (PubChem CID 113403944) has the molecular formula C13H11NO2S2 and a molecular weight of 277.37 g/mol. Its IUPAC name is N-[4-(5-formylthiophen-2-yl)sulfanylphenyl]acetamide.
| Compound Name | N-[4-(5-formylthiophen-2-yl)sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 113403944 |
| Molecular Formula | C13H11NO2S2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | N-[4-(5-formylthiophen-2-yl)sulfanylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Sc2ccc(C=O)s2)cc1 |
| InChI | InChI=1S/C13H11NO2S2/c1-9(16)14-10-2-4-11(5-3-10)17-13-7-6-12(8-15)18-13/h2-8H,1H3,(H,14,16) |
| InChIKey | BDZQNWWXJGKLBB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|