C10H13N3O4 — CID 113406530
6-hydroxy-1-(2-oxo-2-pyrrolidin-1-ylethyl)pyrimidine-2,4-dione (PubChem CID 113406530) has the molecular formula C10H13N3O4 and a molecular weight of 239.23 g/mol. Its IUPAC name is 6-hydroxy-1-(2-oxo-2-pyrrolidin-1-ylethyl)pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-1-(2-oxo-2-pyrrolidin-1-ylethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 113406530 |
| Molecular Formula | C10H13N3O4 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 6-hydroxy-1-(2-oxo-2-pyrrolidin-1-ylethyl)pyrimidine-2,4-dione |
| SMILES | O=C(Cn1c(O)cc(=O)[nH]c1=O)N1CCCC1 |
| InChI | InChI=1S/C10H13N3O4/c14-7-5-8(15)13(10(17)11-7)6-9(16)12-3-1-2-4-12/h5,15H,1-4,6H2,(H,11,14,17) |
| InChIKey | IWJRMAJYXKHZGZ-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |