C18H24N5O2+ — CID 11340745
3-[piperidin-1-ium-1-ylidene(piperidin-1-yl)methoxy]-1,2,3-benzotriazin-4-one (PubChem CID 11340745) has the molecular formula C18H24N5O2+ and a molecular weight of 342.42 g/mol. Its IUPAC name is 3-[piperidin-1-ium-1-ylidene(piperidin-1-yl)methoxy]-1,2,3-benzotriazin-4-one.
| Compound Name | 3-[piperidin-1-ium-1-ylidene(piperidin-1-yl)methoxy]-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 11340745 |
| Molecular Formula | C18H24N5O2+ |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 3-[piperidin-1-ium-1-ylidene(piperidin-1-yl)methoxy]-1,2,3-benzotriazin-4-one |
| SMILES | O=c1c2ccccc2nnn1OC(N1CCCCC1)=[N+]1CCCCC1 |
| InChI | InChI=1S/C18H24N5O2/c24-17-15-9-3-4-10-16(15)19-20-23(17)25-18(21-11-5-1-6-12-21)22-13-7-2-8-14-22/h3-4,9-10H,1-2,5-8,11-14H2/q+1 |
| InChIKey | WTOVNNIGQNQNKQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 63.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|