C12H17N5O2 — CID 66790593
3-[bis(dimethylamino)methoxy]-1,2,3-benzotriazin-4-one (PubChem CID 66790593) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is 3-[bis(dimethylamino)methoxy]-1,2,3-benzotriazin-4-one.
| Compound Name | 3-[bis(dimethylamino)methoxy]-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 66790593 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 3-[bis(dimethylamino)methoxy]-1,2,3-benzotriazin-4-one |
| SMILES | CN(C)C(On1nnc2ccccc2c1=O)N(C)C |
| InChI | InChI=1S/C12H17N5O2/c1-15(2)12(16(3)4)19-17-11(18)9-7-5-6-8-10(9)13-14-17/h5-8,12H,1-4H3 |
| InChIKey | XXMDSYHGMJGYAP-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|