C7H6N3O5P — CID 118622741
(4-oxo-1,2,3-benzotriazin-3-yl) dihydrogen phosphate (PubChem CID 118622741) has the molecular formula C7H6N3O5P and a molecular weight of 243.12 g/mol. Its IUPAC name is (4-oxo-1,2,3-benzotriazin-3-yl) dihydrogen phosphate.
| Compound Name | (4-oxo-1,2,3-benzotriazin-3-yl) dihydrogen phosphate |
|---|---|
| PubChem CID | 118622741 |
| Molecular Formula | C7H6N3O5P |
| Molecular Weight | 243.12 g/mol |
| Exact Mass | 243.00 |
| IUPAC Name | (4-oxo-1,2,3-benzotriazin-3-yl) dihydrogen phosphate |
| SMILES | O=c1c2ccccc2nnn1OP(=O)(O)O |
| InChI | InChI=1S/C7H6N3O5P/c11-7-5-3-1-2-4-6(5)8-9-10(7)15-16(12,13)14/h1-4H,(H2,12,13,14) |
| InChIKey | JUDUUFFEWIHNGX-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.12 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|