C9H9N3NaO3PS2 — CID 23664976
sodium methylsulfanyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methylsulfanyl]phosphinate (PubChem CID 23664976) has the molecular formula C9H9N3NaO3PS2 and a molecular weight of 325.29 g/mol. Its IUPAC name is sodium methylsulfanyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methylsulfanyl]phosphinate.
| Compound Name | sodium methylsulfanyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methylsulfanyl]phosphinate |
|---|---|
| PubChem CID | 23664976 |
| Molecular Formula | C9H9N3NaO3PS2 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 324.97 |
| IUPAC Name | sodium methylsulfanyl-[(4-oxo-1,2,3-benzotriazin-3-yl)methylsulfanyl]phosphinate |
| SMILES | CSP(=O)([O-])SCn1nnc2ccccc2c1=O.[Na+] |
| InChI | InChI=1S/C9H10N3O3PS2.Na/c1-17-16(14,15)18-6-12-9(13)7-4-2-3-5-8(7)10-11-12;/h2-5H,6H2,1H3,(H,14,15);/q;+1/p-1 |
| InChIKey | LPVMNZQWKDDVDN-UHFFFAOYSA-M |
| XLogP | -1.68 |
| TPSA | 87.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|