C9H14F3N5O — CID 113412712
2-[3-(triazol-1-yl)propylamino]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 113412712) has the molecular formula C9H14F3N5O and a molecular weight of 265.24 g/mol. Its IUPAC name is 2-[3-(triazol-1-yl)propylamino]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[3-(triazol-1-yl)propylamino]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 113412712 |
| Molecular Formula | C9H14F3N5O |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-[3-(triazol-1-yl)propylamino]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(CNCCCn1ccnn1)NCC(F)(F)F |
| InChI | InChI=1S/C9H14F3N5O/c10-9(11,12)7-14-8(18)6-13-2-1-4-17-5-3-15-16-17/h3,5,13H,1-2,4,6-7H2,(H,14,18) |
| InChIKey | HLDKOTCPEMRXOW-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|