C12H18O5Si — CID 11346269
(5Z)-3,4-dimethoxy-5-(2-trimethylsilyloxyprop-2-enylidene)furan-2-one (PubChem CID 11346269) has the molecular formula C12H18O5Si and a molecular weight of 270.36 g/mol. Its IUPAC name is (5Z)-3,4-dimethoxy-5-(2-trimethylsilyloxyprop-2-enylidene)furan-2-one.
| Compound Name | (5Z)-3,4-dimethoxy-5-(2-trimethylsilyloxyprop-2-enylidene)furan-2-one |
|---|---|
| PubChem CID | 11346269 |
| Molecular Formula | C12H18O5Si |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (5Z)-3,4-dimethoxy-5-(2-trimethylsilyloxyprop-2-enylidene)furan-2-one |
| SMILES | C=C(/C=C1\OC(=O)C(OC)=C1OC)O[Si](C)(C)C |
| InChI | InChI=1S/C12H18O5Si/c1-8(17-18(4,5)6)7-9-10(14-2)11(15-3)12(13)16-9/h7H,1H2,2-6H3/b9-7- |
| InChIKey | KDTWRVNNKJSPLE-CLFYSBASSA-N |
| XLogP | 2.30 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|