C13H24O4Si — CID 59884443
methyl (2Z)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxypenta-2,4-dienoate (PubChem CID 59884443) has the molecular formula C13H24O4Si and a molecular weight of 272.42 g/mol. Its IUPAC name is methyl (2Z)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxypenta-2,4-dienoate.
| Compound Name | methyl (2Z)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxypenta-2,4-dienoate |
|---|---|
| PubChem CID | 59884443 |
| Molecular Formula | C13H24O4Si |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | methyl (2Z)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxypenta-2,4-dienoate |
| SMILES | C=C(/C=C(\OC)C(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H24O4Si/c1-10(9-11(15-5)12(14)16-6)17-18(7,8)13(2,3)4/h9H,1H2,2-8H3/b11-9- |
| InChIKey | POTDTAHZKHLFAQ-LUAWRHEFSA-N |
| XLogP | 3.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|