C11H20O4Si — CID 123809943
methyl 4-tert-butylsilyloxy-2-methoxypenta-2,4-dienoate (PubChem CID 123809943) has the molecular formula C11H20O4Si and a molecular weight of 244.36 g/mol. Its IUPAC name is methyl 4-tert-butylsilyloxy-2-methoxypenta-2,4-dienoate.
| Compound Name | methyl 4-tert-butylsilyloxy-2-methoxypenta-2,4-dienoate |
|---|---|
| PubChem CID | 123809943 |
| Molecular Formula | C11H20O4Si |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | methyl 4-tert-butylsilyloxy-2-methoxypenta-2,4-dienoate |
| SMILES | C=C(C=C(OC)C(=O)OC)O[SiH2]C(C)(C)C |
| InChI | InChI=1S/C11H20O4Si/c1-8(15-16-11(2,3)4)7-9(13-5)10(12)14-6/h7H,1,16H2,2-6H3 |
| InChIKey | SXZCZYRIHWFBHT-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|