C16H26N2 — CID 113466125
2,6,6-trimethyl-1-[(E)-pent-3-enyl]-5,7-dihydro-4H-indol-4-amine (PubChem CID 113466125) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 2,6,6-trimethyl-1-[(E)-pent-3-enyl]-5,7-dihydro-4H-indol-4-amine.
| Compound Name | 2,6,6-trimethyl-1-[(E)-pent-3-enyl]-5,7-dihydro-4H-indol-4-amine |
|---|---|
| PubChem CID | 113466125 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 2,6,6-trimethyl-1-[(E)-pent-3-enyl]-5,7-dihydro-4H-indol-4-amine |
| SMILES | C/C=C/CCn1c(C)cc2c1CC(C)(C)CC2N |
| InChI | InChI=1S/C16H26N2/c1-5-6-7-8-18-12(2)9-13-14(17)10-16(3,4)11-15(13)18/h5-6,9,14H,7-8,10-11,17H2,1-4H3/b6-5+ |
| InChIKey | CFIBVXIXEHTZBW-AATRIKPKSA-N |
| XLogP | 3.73 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|