C12H13Cl3N2OS — CID 113480263
5,6-dichloro-2-(1-chloroethyl)-1-(2-methylsulfinylethyl)benzimidazole (PubChem CID 113480263) has the molecular formula C12H13Cl3N2OS and a molecular weight of 339.68 g/mol. Its IUPAC name is 5,6-dichloro-2-(1-chloroethyl)-1-(2-methylsulfinylethyl)benzimidazole.
| Compound Name | 5,6-dichloro-2-(1-chloroethyl)-1-(2-methylsulfinylethyl)benzimidazole |
|---|---|
| PubChem CID | 113480263 |
| Molecular Formula | C12H13Cl3N2OS |
| Molecular Weight | 339.68 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | 5,6-dichloro-2-(1-chloroethyl)-1-(2-methylsulfinylethyl)benzimidazole |
| SMILES | CC(Cl)c1nc2cc(Cl)c(Cl)cc2n1CCS(C)=O |
| InChI | InChI=1S/C12H13Cl3N2OS/c1-7(13)12-16-10-5-8(14)9(15)6-11(10)17(12)3-4-19(2)18/h5-7H,3-4H2,1-2H3 |
| InChIKey | FIUXPOWLQADNOV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.68 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|