C21H34O4 — CID 11348685
(4R,5R)-2,2-dimethyl-4,5-bis[(1S)-3-methyl-1-prop-2-enoxybut-3-enyl]-1,3-dioxolane (PubChem CID 11348685) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is (4R,5R)-2,2-dimethyl-4,5-bis[(1S)-3-methyl-1-prop-2-enoxybut-3-enyl]-1,3-dioxolane.
| Compound Name | (4R,5R)-2,2-dimethyl-4,5-bis[(1S)-3-methyl-1-prop-2-enoxybut-3-enyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 11348685 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | (4R,5R)-2,2-dimethyl-4,5-bis[(1S)-3-methyl-1-prop-2-enoxybut-3-enyl]-1,3-dioxolane |
| SMILES | C=CCO[C@@H](CC(=C)C)[C@H]1OC(C)(C)O[C@@H]1[C@H](CC(=C)C)OCC=C |
| InChI | InChI=1S/C21H34O4/c1-9-11-22-17(13-15(3)4)19-20(25-21(7,8)24-19)18(14-16(5)6)23-12-10-2/h9-10,17-20H,1-3,5,11-14H2,4,6-8H3/t17-,18-,19+,20+/m0/s1 |
| InChIKey | YOPLNJTZBZBHSK-VNTMZGSJSA-N |
| XLogP | 4.58 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|