C13H19NO3S2 — CID 113489307
6-(1,4-dithian-2-ylmethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 113489307) has the molecular formula C13H19NO3S2 and a molecular weight of 301.43 g/mol. Its IUPAC name is 6-(1,4-dithian-2-ylmethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-(1,4-dithian-2-ylmethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 113489307 |
| Molecular Formula | C13H19NO3S2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 6-(1,4-dithian-2-ylmethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)C1CC=CCC1C(=O)NCC1CSCCS1 |
| InChI | InChI=1S/C13H19NO3S2/c15-12(14-7-9-8-18-5-6-19-9)10-3-1-2-4-11(10)13(16)17/h1-2,9-11H,3-8H2,(H,14,15)(H,16,17) |
| InChIKey | XDQGGXGKOMQHQW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|