C17H21F3O5S — CID 11349924
ethyl (Z)-3-(difluoromethyl)-3-fluoro-4-(4-methylphenyl)sulfonyloxyhept-4-enoate (PubChem CID 11349924) has the molecular formula C17H21F3O5S and a molecular weight of 394.41 g/mol. Its IUPAC name is ethyl (Z)-3-(difluoromethyl)-3-fluoro-4-(4-methylphenyl)sulfonyloxyhept-4-enoate.
| Compound Name | ethyl (Z)-3-(difluoromethyl)-3-fluoro-4-(4-methylphenyl)sulfonyloxyhept-4-enoate |
|---|---|
| PubChem CID | 11349924 |
| Molecular Formula | C17H21F3O5S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | ethyl (Z)-3-(difluoromethyl)-3-fluoro-4-(4-methylphenyl)sulfonyloxyhept-4-enoate |
| SMILES | CC/C=C(\OS(=O)(=O)c1ccc(C)cc1)C(F)(CC(=O)OCC)C(F)F |
| InChI | InChI=1S/C17H21F3O5S/c1-4-6-14(17(20,16(18)19)11-15(21)24-5-2)25-26(22,23)13-9-7-12(3)8-10-13/h6-10,16H,4-5,11H2,1-3H3/b14-6- |
| InChIKey | VGSOYYSCLFCXAS-NSIKDUERSA-N |
| XLogP | 3.92 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|